/* ui.core.js
 * jQuery UI @VERSION
 *
 * Copyright (c) 2008 Paul Bakaus (ui.jquery.com)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI
 */
;(function($) {

$.ui = {
	plugin: {
		add: function(module, option, set) {
			var proto = $.ui[module].prototype;
			for(var i in set) {
				proto.plugins[i] = proto.plugins[i] || [];
				proto.plugins[i].push([option, set[i]]);
			}
		},
		call: function(instance, name, args) {
			var set = instance.plugins[name];
			if(!set) { return; }
			
			for (var i = 0; i < set.length; i++) {
				if (instance.options[set[i][0]]) {
					set[i][1].apply(instance.element, args);
				}
			}
		}	
	},
	cssCache: {},
	css: function(name) {
		if ($.ui.cssCache[name]) { return $.ui.cssCache[name]; }
		var tmp = $('<div class="ui-gen">').addClass(name).css({position:'absolute', top:'-5000px', left:'-5000px', display:'block'}).appendTo('body');
		
		//if (!$.browser.safari)
			//tmp.appendTo('body'); 
		
		//Opera and Safari set width and height to 0px instead of auto
		//Safari returns rgba(0,0,0,0) when bgcolor is not set
		$.ui.cssCache[name] = !!(
			(!(/auto|default/).test(tmp.css('cursor')) || (/^[1-9]/).test(tmp.css('height')) || (/^[1-9]/).test(tmp.css('width')) || 
			!(/none/).test(tmp.css('backgroundImage')) || !(/transparent|rgba\(0, 0, 0, 0\)/).test(tmp.css('backgroundColor')))
		);
		try { $('body').get(0).removeChild(tmp.get(0));	} catch(e){}
		return $.ui.cssCache[name];
	},
	disableSelection: function(el) {
		$(el).attr('unselectable', 'on').css('MozUserSelect', 'none');
	},
	enableSelection: function(el) {
		$(el).attr('unselectable', 'off').css('MozUserSelect', '');
	},
	hasScroll: function(e, a) {
		var scroll = /top/.test(a||"top") ? 'scrollTop' : 'scrollLeft', has = false;
		if (e[scroll] > 0) return true; e[scroll] = 1;
		has = e[scroll] > 0 ? true : false; e[scroll] = 0;
		return has;
	}
};


/** jQuery core modifications and additions **/

var _remove = $.fn.remove;
$.fn.remove = function() {
	$("*", this).add(this).triggerHandler("remove");
	return _remove.apply(this, arguments );
};

// $.widget is a factory to create jQuery plugins
// taking some boilerplate code out of the plugin code
// created by Scott González and Jörn Zaefferer
function getter(namespace, plugin, method) {
	var methods = $[namespace][plugin].getter || [];
	methods = (typeof methods == "string" ? methods.split(/,?\s+/) : methods);
	return ($.inArray(method, methods) != -1);
}

$.widget = function(name, prototype) {
	var namespace = name.split(".")[0];
	name = name.split(".")[1];
	
	// create plugin method
	$.fn[name] = function(options) {
		var isMethodCall = (typeof options == 'string'),
			args = Array.prototype.slice.call(arguments, 1);
		
		if (isMethodCall && getter(namespace, name, options)) {
			var instance = $.data(this[0], name);
			return (instance ? instance[options].apply(instance, args)
				: undefined);
		}
		
		return this.each(function() {
			var instance = $.data(this, name);
			if (isMethodCall && instance && $.isFunction(instance[options])) {
				instance[options].apply(instance, args);
			} else if (!isMethodCall) {
				$.data(this, name, new $[namespace][name](this, options));
			}
		});
	};
	
	// create widget constructor
	$[namespace][name] = function(element, options) {
		var self = this;
		
		this.widgetName = name;
		this.widgetBaseClass = namespace + '-' + name;
		
		this.options = $.extend({}, $.widget.defaults, $[namespace][name].defaults, options);
		this.element = $(element)
			.bind('setData.' + name, function(e, key, value) {
				return self.setData(key, value);
			})
			.bind('getData.' + name, function(e, key) {
				return self.getData(key);
			})
			.bind('remove', function() {
				return self.destroy();
			});
		this.init();
	};
	
	// add widget prototype
	$[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype);
};

$.widget.prototype = {
	init: function() {},
	destroy: function() {
		this.element.removeData(this.widgetName);
	},
	
	getData: function(key) {
		return this.options[key];
	},
	setData: function(key, value) {
		this.options[key] = value;
		
		if (key == 'disabled') {
			this.element[value ? 'addClass' : 'removeClass'](
				this.widgetBaseClass + '-disabled');
		}
	},
	
	enable: function() {
		this.setData('disabled', false);
	},
	disable: function() {
		this.setData('disabled', true);
	}
};

$.widget.defaults = {
	disabled: false
};


/** Mouse Interaction Plugin **/

$.ui.mouse = {
	mouseInit: function() {
		var self = this;
	
		this.element.bind('mousedown.'+this.widgetName, function(e) {
			return self.mouseDown(e);
		});
		
		// Prevent text selection in IE
		if ($.browser.msie) {
			this._mouseUnselectable = this.element.attr('unselectable');
			this.element.attr('unselectable', 'on');
		}
		
		this.started = false;
	},
	
	// TODO: make sure destroying one instance of mouse doesn't mess with
	// other instances of mouse
	mouseDestroy: function() {
		this.element.unbind('.'+this.widgetName);
		
		// Restore text selection in IE
		($.browser.msie
			&& this.element.attr('unselectable', this._mouseUnselectable));
	},
	
	mouseDown: function(e) {
		// we may have missed mouseup (out of window)
		(this._mouseStarted && this.mouseUp(e));
		
		this._mouseDownEvent = e;
		
		var self = this,
			btnIsLeft = (e.which == 1),
			elIsCancel = (typeof this.options.cancel == "string" ? $(e.target).parents().add(e.target).filter(this.options.cancel).length : false);
		if (!btnIsLeft || elIsCancel || !this.mouseCapture(e)) {
			return true;
		}
		
		this._mouseDelayMet = !this.options.delay;
		if (!this._mouseDelayMet) {
			this._mouseDelayTimer = setTimeout(function() {
				self._mouseDelayMet = true;
			}, this.options.delay);
		}
		
		if (this.mouseDistanceMet(e) && this.mouseDelayMet(e)) {
			this._mouseStarted = (this.mouseStart(e) !== false);
			if (!this._mouseStarted) {
				e.preventDefault();
				return true;
			}
		}
		
		// these delegates are required to keep context
		this._mouseMoveDelegate = function(e) {
			return self.mouseMove(e);
		};
		this._mouseUpDelegate = function(e) {
			return self.mouseUp(e);
		};
		$(document)
			.bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
			.bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
		
		return false;
	},
	
	mouseMove: function(e) {
		// IE mouseup check - mouseup happened when mouse was out of window
		if ($.browser.msie && !e.button) {
			return this.mouseUp(e);
		}
		
		if (this._mouseStarted) {
			this.mouseDrag(e);
			return false;
		}
		
		if (this.mouseDistanceMet(e) && this.mouseDelayMet(e)) {
			this._mouseStarted =
				(this.mouseStart(this._mouseDownEvent, e) !== false);
			(this._mouseStarted ? this.mouseDrag(e) : this.mouseUp(e));
		}
		
		return !this._mouseStarted;
	},
	
	mouseUp: function(e) {
		$(document)
			.unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
			.unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
		
		if (this._mouseStarted) {
			this._mouseStarted = false;
			this.mouseStop(e);
		}
		
		return false;
	},
	
	mouseDistanceMet: function(e) {
		return (Math.max(
				Math.abs(this._mouseDownEvent.pageX - e.pageX),
				Math.abs(this._mouseDownEvent.pageY - e.pageY)
			) >= this.options.distance
		);
	},
	
	mouseDelayMet: function(e) {
		return this._mouseDelayMet;
	},
	
	// These are placeholder methods, to be overriden by extending plugin
	mouseStart: function(e) {},
	mouseDrag: function(e) {},
	mouseStop: function(e) {},
	mouseCapture: function(e) { return true; }
};

$.ui.mouse.defaults = {
	cancel: null,
	distance: 1,
	delay: 0
};

})(jQuery);



/* 
 * jquery.autogrow.js 
 *
 * Auto Expanding Text Area (1.2.2)
 * by Chrys Bader (www.chrysbader.com)
 * chrysb@gmail.com
 *
 * Special thanks to:
 * Jake Chapa - jake@hybridstudio.com
 * John Resig - jeresig@gmail.com
 *
 * Copyright (c) 2008 Chrys Bader (www.chrysbader.com)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 *
 * NOTE: This script requires jQuery to work.  Download jQuery at www.jquery.com
 *
 */
 
(function(jQuery) {
		  
	var self = null;
 
	jQuery.fn.autogrow = function(o)
	{	
		return this.each(function() {
			new jQuery.autogrow(this, o);
		});
	};
	

    /**
     * The autogrow object.
     *
     * @constructor
     * @name jQuery.autogrow
     * @param Object e The textarea to create the autogrow for.
     * @param Hash o A set of key/value pairs to set as configuration properties.
     * @cat Plugins/autogrow
     */
	
	jQuery.autogrow = function (e, o)
	{
		this.options		  	= o || {};
		this.dummy			  	= null;
		this.interval	 	  	= null;
		this.line_height	  	= this.options.lineHeight || parseInt(jQuery(e).css('line-height'));
		this.min_height		  	= this.options.minHeight || parseInt(jQuery(e).css('min-height'));
		this.max_height		  	= this.options.maxHeight || parseInt(jQuery(e).css('max-height'));;
		this.textarea		  	= jQuery(e);
		
		if(this.line_height == NaN)
		  this.line_height = 0;
		
		// Only one textarea activated at a time, the one being used
		this.init();
	};
	
	jQuery.autogrow.fn = jQuery.autogrow.prototype = {
    autogrow: '1.2.2'
  };
	
 	jQuery.autogrow.fn.extend = jQuery.autogrow.extend = jQuery.extend;
	
	jQuery.autogrow.fn.extend({
						 
		init: function() {			
			var self = this;			
			this.textarea.css({overflow: 'hidden', display: 'block'});
			this.textarea.bind('focus', function() { self.startExpand() } ).bind('blur', function() { self.stopExpand() });
			this.checkExpand();	
		},
						 
		startExpand: function() {				
		  var self = this;
			this.interval = window.setInterval(function() {self.checkExpand()}, 400);
		},
		
		stopExpand: function() {
			clearInterval(this.interval);	
		},
		
		checkExpand: function() {
			
			if (this.dummy == null)
			{
				this.dummy = jQuery('<div></div>');
				this.dummy.css({
												'font-size'  : this.textarea.css('font-size'),
												'font-family': this.textarea.css('font-family'),
												'width'      : this.textarea.css('width'),
												'line-height': '16px',
												'overflow-x' : 'hidden',
												'position'   : 'absolute',
												'top'        : 0,
												'left'		 : -9999
												}).appendTo('body');
			}
			
			// Strip HTML tags
			var html = this.textarea.val().replace(/(<|>)/g, '');
			
			// IE is different, as per usual
			if ($.browser.msie)
			{
				html = html.replace(/\n/g, '<BR>new');
			}
			else
			{
				html = html.replace(/\n/g, '<br>new');
			}
			
			if (this.dummy.html() != html)
			{
				this.dummy.html(html);	
				
				if (this.max_height > 0 && (this.dummy.height() + 16 > this.max_height))
				{
					this.textarea.css('overflow-y', 'auto');	
				}
				else
				{
					this.textarea.css('overflow-y', 'hidden');
					if (this.textarea.height() < this.dummy.height() + 16 || (this.dummy.height() < this.textarea.height()))
					{	
						this.textarea.animate({height: (this.dummy.height() + 16) + 'px'}, 100);	
					}
				}
			}
		}
						 
	 });
})(jQuery);


/*
 * jQuery UI Accordion
 * 
 * Copyright (c) 2007, 2008 Jörn Zaefferer
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Accordion
 *
 * Depends:
 *	ui.core.js
 */
(function($) {

$.widget("ui.accordion", {
	init: function() {
		var options = this.options;
		
		if ( options.navigation ) {
			var current = this.element.find("a").filter(options.navigationFilter);
			if ( current.length ) {
				if ( current.filter(options.header).length ) {
					options.active = current;
				} else {
					options.active = current.parent().parent().prev();
					current.addClass("current");
				}
			}
		}
		
		// calculate active if not specified, using the first header
		options.headers = this.element.find(options.header);
		options.active = findActive(options.headers, options.active);
		
		// IE7-/Win - Extra vertical space in Lists fixed
		if ($.browser.msie) {
			this.element.find('a').css('zoom', '1');
		}
		
		if (!this.element.hasClass("ui-accordion")) {
			this.element.addClass("ui-accordion");
			$("<span class='ui-accordion-left'/>").insertBefore(options.headers);
			$("<span class='ui-accordion-right'/>").appendTo(options.headers);
			options.headers.addClass("ui-accordion-header").attr("tabindex", "0");
		}
		
		var maxHeight;
		if ( options.fillSpace ) {
			maxHeight = this.element.parent().height();
			options.headers.each(function() {
				maxHeight -= $(this).outerHeight();
			});
			var maxPadding = 0;
			options.headers.next().each(function() {
				maxPadding = Math.max(maxPadding, $(this).innerHeight() - $(this).height());
			}).height(maxHeight - maxPadding);
		} else if ( options.autoHeight ) {
			maxHeight = 0;
			options.headers.next().each(function() {
				maxHeight = Math.max(maxHeight, $(this).outerHeight());
			}).height(maxHeight);
		}
	
		options.headers
			.not(options.active || "")
			.next()
			.hide();
		options.active.parent().andSelf().addClass(options.selectedClass);
		
		if (options.event) {
			this.element.bind((options.event) + ".accordion", clickHandler);
		}
	},
	activate: function(index) {
		// call clickHandler with custom event
		clickHandler.call(this.element[0], {
			target: findActive( this.options.headers, index )[0]
		});
	},
	destroy: function() {
		this.options.headers.next().css("display", "");
		if ( this.options.fillSpace || this.options.autoHeight ) {
			this.options.headers.next().css("height", "");
		}
		$.removeData(this.element[0], "accordion");
		this.element.removeClass("ui-accordion").unbind(".accordion");
	}
});

function scopeCallback(callback, scope) {
	return function() {
		return callback.apply(scope, arguments);
	};
};

function completed(cancel) {
	// if removed while animated data can be empty
	if (!$.data(this, "accordion")) {
		return;
	}
	
	var instance = $.data(this, "accordion");
	var options = instance.options;
	options.running = cancel ? 0 : --options.running;
	if ( options.running ) {
		return;
	}
	if ( options.clearStyle ) {
		options.toShow.add(options.toHide).css({
			height: "",
			overflow: ""
		});
	}
	$(this).triggerHandler("accordionchange", [$.event.fix({type: 'accordionchange', target: instance.element[0]}), options.data], options.change);
}

function toggle(toShow, toHide, data, clickedActive, down) {
	var options = $.data(this, "accordion").options;
	options.toShow = toShow;
	options.toHide = toHide;
	options.data = data;
	var complete = scopeCallback(completed, this);
	
	// count elements to animate
	options.running = toHide.size() === 0 ? toShow.size() : toHide.size();
	
	if ( options.animated ) {
		if ( !options.alwaysOpen && clickedActive ) {
			$.ui.accordion.animations[options.animated]({
				toShow: jQuery([]),
				toHide: toHide,
				complete: complete,
				down: down,
				autoHeight: options.autoHeight
			});
		} else {
			$.ui.accordion.animations[options.animated]({
				toShow: toShow,
				toHide: toHide,
				complete: complete,
				down: down,
				autoHeight: options.autoHeight
			});
		}
	} else {
		if ( !options.alwaysOpen && clickedActive ) {
			toShow.toggle();
		} else {
			toHide.hide();
			toShow.show();
		}
		complete(true);
	}
}

function clickHandler(event) {
	var options = $.data(this, "accordion").options;
	if (options.disabled) {
		return false;
	}
	
	// called only when using activate(false) to close all parts programmatically
	if ( !event.target && !options.alwaysOpen ) {
		options.active.parent().andSelf().toggleClass(options.selectedClass);
		var toHide = options.active.next(),
			data = {
				options: options,
				newHeader: jQuery([]),
				oldHeader: options.active,
				newContent: jQuery([]),
				oldContent: toHide
			},
			toShow = (options.active = $([]));
		toggle.call(this, toShow, toHide, data );
		return false;
	}
	// get the click target
	var clicked = $(event.target);
	
	// due to the event delegation model, we have to check if one
	// of the parent elements is our actual header, and find that
	// otherwise stick with the initial target
	clicked = $( clicked.parents(options.header)[0] || clicked );
	
	var clickedActive = clicked[0] == options.active[0];
	
	// if animations are still active, or the active header is the target, ignore click
	if (options.running || (options.alwaysOpen && clickedActive)) {
		return false;
	}
	if (!clicked.is(options.header)) {
		return;
	}
	
	// switch classes
	options.active.parent().andSelf().toggleClass(options.selectedClass);
	if ( !clickedActive ) {
		clicked.parent().andSelf().addClass(options.selectedClass);
	}
	
	// find elements to show and hide
	var toShow = clicked.next(),
		toHide = options.active.next(),
		//data = [clicked, options.active, toShow, toHide],
		data = {
			options: options,
			newHeader: clicked,
			oldHeader: options.active,
			newContent: toShow,
			oldContent: toHide
		},
		down = options.headers.index( options.active[0] ) > options.headers.index( clicked[0] );
	
	options.active = clickedActive ? $([]) : clicked;
	toggle.call(this, toShow, toHide, data, clickedActive, down );

	return false;
};

function findActive(headers, selector) {
	return selector != undefined
		? typeof selector == "number"
			? headers.filter(":eq(" + selector + ")")
			: headers.not(headers.not(selector))
		: selector === false
			? $([])
			: headers.filter(":eq(0)");
}

$.extend($.ui.accordion, {
	defaults: {
		selectedClass: "selected",
		alwaysOpen: true,
		animated: 'slide',
		event: "click",
		header: "a",
		autoHeight: true,
		running: 0,
		navigationFilter: function() {
			return this.href.toLowerCase() == location.href.toLowerCase();
		}
	},
	animations: {
		slide: function(options, additions) {
			options = $.extend({
				easing: "swing",
				duration: 300
			}, options, additions);
			if ( !options.toHide.size() ) {
				options.toShow.animate({height: "show"}, options);
				return;
			}
			var hideHeight = options.toHide.height(),
				showHeight = options.toShow.height(),
				difference = showHeight / hideHeight;
			options.toShow.css({ height: 0, overflow: 'hidden' }).show();
			options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate({height:"hide"},{
				step: function(now) {
					var current = (hideHeight - now) * difference;
					if ($.browser.msie || $.browser.opera) {
						current = Math.ceil(current);
					}
					options.toShow.height( current );
				},
				duration: options.duration,
				easing: options.easing,
				complete: function() {
					if ( !options.autoHeight ) {
						options.toShow.css("height", "auto");
					}
					options.complete();
				}
			});
		},
		bounceslide: function(options) {
			this.slide(options, {
				easing: options.down ? "bounceout" : "swing",
				duration: options.down ? 1000 : 200
			});
		},
		easeslide: function(options) {
			this.slide(options, {
				easing: "easeinout",
				duration: 700
			});
		}
	}
});

// deprecated, use accordion("activate", index) instead
$.fn.activate = function(index) {
	return this.accordion("activate", index);
};

})(jQuery);


if (!this.JSON) {
    JSON = {};
}
(function () {

    function f(n) {
        // Format integers to have at least two digits.
        return n < 10 ? '0' + n : n;
    }

    if (typeof Date.prototype.toJSON !== 'function') {

        Date.prototype.toJSON = function (key) {

            return this.getUTCFullYear()   + '-' +
                 f(this.getUTCMonth() + 1) + '-' +
                 f(this.getUTCDate())      + 'T' +
                 f(this.getUTCHours())     + ':' +
                 f(this.getUTCMinutes())   + ':' +
                 f(this.getUTCSeconds())   + 'Z';
        };

        String.prototype.toJSON =
        Number.prototype.toJSON =
        Boolean.prototype.toJSON = function (key) {
            return this.valueOf();
        };
    }

    var cx = /[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,
        escapable = /[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,
        gap,
        indent,
        meta = {    // table of character substitutions
            '\b': '\\b',
            '\t': '\\t',
            '\n': '\\n',
            '\f': '\\f',
            '\r': '\\r',
            '"' : '\\"',
            '\\': '\\\\'
        },
        rep;


    function quote(string) {

// If the string contains no control characters, no quote characters, and no
// backslash characters, then we can safely slap some quotes around it.
// Otherwise we must also replace the offending characters with safe escape
// sequences.

        escapable.lastIndex = 0;
        return escapable.test(string) ?
            '"' + string.replace(escapable, function (a) {
                var c = meta[a];
                return typeof c === 'string' ? c :
                    '\\u' + ('0000' + a.charCodeAt(0).toString(16)).slice(-4);
            }) + '"' :
            '"' + string + '"';
    }


    function str(key, holder) {

// Produce a string from holder[key].

        var i,          // The loop counter.
            k,          // The member key.
            v,          // The member value.
            length,
            mind = gap,
            partial,
            value = holder[key];

// If the value has a toJSON method, call it to obtain a replacement value.

        if (value && typeof value === 'object' &&
                typeof value.toJSON === 'function') {
            value = value.toJSON(key);
        }

// If we were called with a replacer function, then call the replacer to
// obtain a replacement value.

        if (typeof rep === 'function') {
            value = rep.call(holder, key, value);
        }

// What happens next depends on the value's type.

        switch (typeof value) {
        case 'string':
            return quote(value);

        case 'number':

// JSON numbers must be finite. Encode non-finite numbers as null.

            return isFinite(value) ? String(value) : 'null';

        case 'boolean':
        case 'null':

// If the value is a boolean or null, convert it to a string. Note:
// typeof null does not produce 'null'. The case is included here in
// the remote chance that this gets fixed someday.

            return String(value);

// If the type is 'object', we might be dealing with an object or an array or
// null.

        case 'object':

// Due to a specification blunder in ECMAScript, typeof null is 'object',
// so watch out for that case.

            if (!value) {
                return 'null';
            }

// Make an array to hold the partial results of stringifying this object value.

            gap += indent;
            partial = [];

// Is the value an array?

            if (Object.prototype.toString.apply(value) === '[object Array]') {

// The value is an array. Stringify every element. Use null as a placeholder
// for non-JSON values.

                length = value.length;
                for (i = 0; i < length; i += 1) {
                    partial[i] = str(i, value) || 'null';
                }

// Join all of the elements together, separated with commas, and wrap them in
// brackets.

                v = partial.length === 0 ? '[]' :
                    gap ? '[\n' + gap +
                            partial.join(',\n' + gap) + '\n' +
                                mind + ']' :
                          '[' + partial.join(',') + ']';
                gap = mind;
                return v;
            }

// If the replacer is an array, use it to select the members to be stringified.

            if (rep && typeof rep === 'object') {
                length = rep.length;
                for (i = 0; i < length; i += 1) {
                    k = rep[i];
                    if (typeof k === 'string') {
                        v = str(k, value);
                        if (v) {
                            partial.push(quote(k) + (gap ? ': ' : ':') + v);
                        }
                    }
                }
            } else {

// Otherwise, iterate through all of the keys in the object.

                for (k in value) {
                    if (Object.hasOwnProperty.call(value, k)) {
                        v = str(k, value);
                        if (v) {
                            partial.push(quote(k) + (gap ? ': ' : ':') + v);
                        }
                    }
                }
            }

// Join all of the member texts together, separated with commas,
// and wrap them in braces.

            v = partial.length === 0 ? '{}' :
                gap ? '{\n' + gap + partial.join(',\n' + gap) + '\n' +
                        mind + '}' : '{' + partial.join(',') + '}';
            gap = mind;
            return v;
        }
    }

// If the JSON object does not yet have a stringify method, give it one.

    if (typeof JSON.stringify !== 'function') {
        JSON.stringify = function (value, replacer, space) {

// The stringify method takes a value and an optional replacer, and an optional
// space parameter, and returns a JSON text. The replacer can be a function
// that can replace values, or an array of strings that will select the keys.
// A default replacer method can be provided. Use of the space parameter can
// produce text that is more easily readable.

            var i;
            gap = '';
            indent = '';

// If the space parameter is a number, make an indent string containing that
// many spaces.

            if (typeof space === 'number') {
                for (i = 0; i < space; i += 1) {
                    indent += ' ';
                }

// If the space parameter is a string, it will be used as the indent string.

            } else if (typeof space === 'string') {
                indent = space;
            }

// If there is a replacer, it must be a function or an array.
// Otherwise, throw an error.

            rep = replacer;
            if (replacer && typeof replacer !== 'function' &&
                    (typeof replacer !== 'object' ||
                     typeof replacer.length !== 'number')) {
                throw new Error('JSON.stringify');
            }

// Make a fake root object containing our value under the key of ''.
// Return the result of stringifying the value.

            return str('', {'': value});
        };
    }


// If the JSON object does not yet have a parse method, give it one.

    if (typeof JSON.parse !== 'function') {
        JSON.parse = function (text, reviver) {

// The parse method takes a text and an optional reviver function, and returns
// a JavaScript value if the text is a valid JSON text.

            var j;

            function walk(holder, key) {

// The walk method is used to recursively walk the resulting structure so
// that modifications can be made.

                var k, v, value = holder[key];
                if (value && typeof value === 'object') {
                    for (k in value) {
                        if (Object.hasOwnProperty.call(value, k)) {
                            v = walk(value, k);
                            if (v !== undefined) {
                                value[k] = v;
                            } else {
                                delete value[k];
                            }
                        }
                    }
                }
                return reviver.call(holder, key, value);
            }


// Parsing happens in four stages. In the first stage, we replace certain
// Unicode characters with escape sequences. JavaScript handles many characters
// incorrectly, either silently deleting them, or treating them as line endings.

            cx.lastIndex = 0;
            if (cx.test(text)) {
                text = text.replace(cx, function (a) {
                    return '\\u' +
                        ('0000' + a.charCodeAt(0).toString(16)).slice(-4);
                });
            }

// In the second stage, we run the text against regular expressions that look
// for non-JSON patterns. We are especially concerned with '()' and 'new'
// because they can cause invocation, and '=' because it can cause mutation.
// But just to be safe, we want to reject all unexpected forms.

// We split the second stage into 4 regexp operations in order to work around
// crippling inefficiencies in IE's and Safari's regexp engines. First we
// replace the JSON backslash pairs with '@' (a non-JSON character). Second, we
// replace all simple value tokens with ']' characters. Third, we delete all
// open brackets that follow a colon or comma or that begin the text. Finally,
// we look to see that the remaining characters are only whitespace or ']' or
// ',' or ':' or '{' or '}'. If that is so, then the text is safe for eval.

            if (/^[\],:{}\s]*$/.
test(text.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, '@').
replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, ']').
replace(/(?:^|:|,)(?:\s*\[)+/g, ''))) {

// In the third stage we use the eval function to compile the text into a
// JavaScript structure. The '{' operator is subject to a syntactic ambiguity
// in JavaScript: it can begin a block or an object literal. We wrap the text
// in parens to eliminate the ambiguity.

                j = eval('(' + text + ')');

// In the optional fourth stage, we recursively walk the new structure, passing
// each name/value pair to a reviver function for possible transformation.

                return typeof reviver === 'function' ?
                    walk({'': j}, '') : j;
            }

// If the text is not JSON parseable, then a SyntaxError is thrown.

            throw new SyntaxError('JSON.parse');
        };
    }
})();


/**
 * Cookie plugin
 *
 * Copyright (c) 2006 Klaus Hartl (stilbuero.de)
 * Dual licensed under the MIT and GPL licenses:
 * http://www.opensource.org/licenses/mit-license.php
 * http://www.gnu.org/licenses/gpl.html
 *
 */

/**
 * Create a cookie with the given name and value and other optional parameters.
 *
 * @example $.cookie('the_cookie', 'the_value');
 * @desc Set the value of a cookie.
 * @example $.cookie('the_cookie', 'the_value', { expires: 7, path: '/', domain: 'jquery.com', secure: true });
 * @desc Create a cookie with all available options.
 * @example $.cookie('the_cookie', 'the_value');
 * @desc Create a session cookie.
 * @example $.cookie('the_cookie', null);
 * @desc Delete a cookie by passing null as value. Keep in mind that you have to use the same path and domain
 *       used when the cookie was set.
 *
 * @param String name The name of the cookie.
 * @param String value The value of the cookie.
 * @param Object options An object literal containing key/value pairs to provide optional cookie attributes.
 * @option Number|Date expires Either an integer specifying the expiration date from now on in days or a Date object.
 *                             If a negative value is specified (e.g. a date in the past), the cookie will be deleted.
 *                             If set to null or omitted, the cookie will be a session cookie and will not be retained
 *                             when the the browser exits.
 * @option String path The value of the path atribute of the cookie (default: path of page that created the cookie).
 * @option String domain The value of the domain attribute of the cookie (default: domain of page that created the cookie).
 * @option Boolean secure If true, the secure attribute of the cookie will be set and the cookie transmission will
 *                        require a secure protocol (like HTTPS).
 * @type undefined
 *
 * @name $.cookie
 * @cat Plugins/Cookie
 * @author Klaus Hartl/klaus.hartl@stilbuero.de
 */

/**
 * Get the value of a cookie with the given name.
 *
 * @example $.cookie('the_cookie');
 * @desc Get the value of a cookie.
 *
 * @param String name The name of the cookie.
 * @return The value of the cookie.
 * @type String
 *
 * @name $.cookie
 * @cat Plugins/Cookie
 * @author Klaus Hartl/klaus.hartl@stilbuero.de
 */
jQuery.cookie = function(name, value, options) {
    if (typeof value != 'undefined') { // name and value given, set cookie
        options = options || {};
        if (value === null) {
            value = '';
            options.expires = -1;
        }
        var expires = '';
        if (options.expires && (typeof options.expires == 'number' || options.expires.toUTCString)) {
            var date;
            if (typeof options.expires == 'number') {
                date = new Date();
                date.setTime(date.getTime() + (options.expires * 24 * 60 * 60 * 1000));
            } else {
                date = options.expires;
            }
            expires = '; expires=' + date.toUTCString(); // use expires attribute, max-age is not supported by IE
        }
        // CAUTION: Needed to parenthesize options.path and options.domain
        // in the following expressions, otherwise they evaluate to undefined
        // in the packed version for some reason...
        var path = options.path ? '; path=' + (options.path) : '';
        var domain = options.domain ? '; domain=' + (options.domain) : '';
        var secure = options.secure ? '; secure' : '';
        document.cookie = [name, '=', encodeURIComponent(value), expires, path, domain, secure].join('');
    } else { // only name given, get cookie
        var cookieValue = null;
        if (document.cookie && document.cookie != '') {
            var cookies = document.cookie.split(';');
            for (var i = 0; i < cookies.length; i++) {
                var cookie = jQuery.trim(cookies[i]);
                // Does this cookie string begin with the name we want?
                if (cookie.substring(0, name.length + 1) == (name + '=')) {
                    cookieValue = decodeURIComponent(cookie.substring(name.length + 1));
                    break;
                }
            }
        }
        return cookieValue;
    }
};


/*
 * jQuery Tooltip plugin 1.3
 *
 * http://bassistance.de/jquery-plugins/jquery-plugin-tooltip/
 * http://docs.jquery.com/Plugins/Tooltip
 *
 * Copyright (c) 2006 - 2008 Jörn Zaefferer
 *
 * $Id: jquery.tooltip.js 5741 2008-06-21 15:22:16Z joern.zaefferer $
 * 
 * Dual licensed under the MIT and GPL licenses:
 *   http://www.opensource.org/licenses/mit-license.php
 *   http://www.gnu.org/licenses/gpl.html
 */
 
;(function($) {
	
		// the tooltip element
	var helper = {},
		// the current tooltipped element
		current,
		// the title of the current element, used for restoring
		title,
		// timeout id for delayed tooltips
		tID,
		// IE 5.5 or 6
		IE = $.browser.msie && /MSIE\s(5\.5|6\.)/.test(navigator.userAgent),
		// flag for mouse tracking
		track = false;
	
	$.tooltip = {
		blocked: false,
		defaults: {
			delay: 200,
			fade: false,
			showURL: true,
			extraClass: "",
			top: 15,
			left: 15,
			id: "tooltip"
		},
		block: function() {
			$.tooltip.blocked = !$.tooltip.blocked;
		}
	};
	
	$.fn.extend({
		tooltip: function(settings) {
			settings = $.extend({}, $.tooltip.defaults, settings);
			createHelper(settings);
			return this.each(function() {
					$.data(this, "tooltip", settings);
					this.tOpacity = helper.parent.css("opacity");
					// copy tooltip into its own expando and remove the title
					this.tooltipText = this.title;
					$(this).removeAttr("title");
					// also remove alt attribute to prevent default tooltip in IE
					this.alt = "";
				})
				.mouseover(save)
				.mouseout(hide)
				.click(hide);
		},
		fixPNG: IE ? function() {
			return this.each(function () {
				var image = $(this).css('backgroundImage');
				if (image.match(/^url\(["']?(.*\.png)["']?\)$/i)) {
					image = RegExp.$1;
					$(this).css({
						'backgroundImage': 'none',
						'filter': "progid:DXImageTransform.Microsoft.AlphaImageLoader(enabled=true, sizingMethod=crop, src='" + image + "')"
					}).each(function () {
						var position = $(this).css('position');
						if (position != 'absolute' && position != 'relative')
							$(this).css('position', 'relative');
					});
				}
			});
		} : function() { return this; },
		unfixPNG: IE ? function() {
			return this.each(function () {
				$(this).css({'filter': '', backgroundImage: ''});
			});
		} : function() { return this; },
		hideWhenEmpty: function() {
			return this.each(function() {
				$(this)[ $(this).html() ? "show" : "hide" ]();
			});
		},
		url: function() {
			return this.attr('href') || this.attr('src');
		}
	});
	
	function createHelper(settings) {
		// there can be only one tooltip helper
		if( helper.parent )
			return;
		// create the helper, h3 for title, div for url
		helper.parent = $('<div id="' + settings.id + '"><h3></h3><div class="body"></div><div class="url"></div></div>')
			// add to document
			.appendTo(document.body)
			// hide it at first
			.hide();
			
		// apply bgiframe if available
		if ( $.fn.bgiframe )
			helper.parent.bgiframe();
		
		// save references to title and url elements
		helper.title = $('h3', helper.parent);
		helper.body = $('div.body', helper.parent);
		helper.url = $('div.url', helper.parent);
	}
	
	function settings(element) {
		return $.data(element, "tooltip");
	}
	
	// main event handler to start showing tooltips
	function handle(event) {
		// show helper, either with timeout or on instant
		if( settings(this).delay )
			tID = setTimeout(show, settings(this).delay);
		else
			show();
		
		// if selected, update the helper position when the mouse moves
		track = !!settings(this).track;
		$(document.body).bind('mousemove', update);
			
		// update at least once
		update(event);
	}
	
	// save elements title before the tooltip is displayed
	function save() {
		// if this is the current source, or it has no title (occurs with click event), stop
		if ( $.tooltip.blocked || this == current || (!this.tooltipText && !settings(this).bodyHandler) )
			return;

		// save current
		current = this;
		title = this.tooltipText;
		
		if ( settings(this).bodyHandler ) {
			helper.title.hide();
			var bodyContent = settings(this).bodyHandler.call(this);
			if (bodyContent.nodeType || bodyContent.jquery) {
				helper.body.empty().append(bodyContent)
			} else {
				helper.body.html( bodyContent );
			}
			helper.body.show();
		} else if ( settings(this).showBody ) {
			var parts = title.split(settings(this).showBody);
			helper.title.html(parts.shift()).show();
			helper.body.empty();
			for(var i = 0, part; (part = parts[i]); i++) {
				if(i > 0)
					helper.body.append("<br/>");
				helper.body.append(part);
			}
			helper.body.hideWhenEmpty();
		} else {
			helper.title.html(title).show();
			helper.body.hide();
		}
		
		// if element has href or src, add and show it, otherwise hide it
		if( settings(this).showURL && $(this).url() )
			helper.url.html( $(this).url().replace('http://', '') ).show();
		else 
			helper.url.hide();
		
		// add an optional class for this tip
		helper.parent.addClass(settings(this).extraClass);

		// fix PNG background for IE
		if (settings(this).fixPNG )
			helper.parent.fixPNG();
			
		handle.apply(this, arguments);
	}
	
	// delete timeout and show helper
	function show() {
		tID = null;
		if ((!IE || !$.fn.bgiframe) && settings(current).fade) {
			if (helper.parent.is(":animated"))
				helper.parent.stop().show().fadeTo(settings(current).fade, current.tOpacity);
			else
				helper.parent.is(':visible') ? helper.parent.fadeTo(settings(current).fade, current.tOpacity) : helper.parent.fadeIn(settings(current).fade);
		} else {
			helper.parent.show();
		}
		update();
	}
	
	/**
	 * callback for mousemove
	 * updates the helper position
	 * removes itself when no current element
	 */
	function update(event)	{
		if($.tooltip.blocked)
			return;
		
		if (event && event.target.tagName == "OPTION") {
			return;
		}
		
		// stop updating when tracking is disabled and the tooltip is visible
		if ( !track && helper.parent.is(":visible")) {
			$(document.body).unbind('mousemove', update)
		}
		
		// if no current element is available, remove this listener
		if( current == null ) {
			$(document.body).unbind('mousemove', update);
			return;	
		}
		
		// remove position helper classes
		helper.parent.removeClass("viewport-right").removeClass("viewport-bottom");
		
		var left = helper.parent[0].offsetLeft;
		var top = helper.parent[0].offsetTop;
		if (event) {
			// position the helper 15 pixel to bottom right, starting from mouse position
			left = event.pageX + settings(current).left;
			top = event.pageY + settings(current).top;
			var right='auto';
			if (settings(current).positionLeft) {
				right = $(window).width() - left;
				left = 'auto';
			}
			helper.parent.css({
				left: left,
				right: right,
				top: top
			});
		}
		
		var v = viewport(),
			h = helper.parent[0];
		// check horizontal position
		if (v.x + v.cx < h.offsetLeft + h.offsetWidth) {
			left -= h.offsetWidth + 20 + settings(current).left;
			helper.parent.css({left: left + 'px'}).addClass("viewport-right");
		}
		// check vertical position
		if (v.y + v.cy < h.offsetTop + h.offsetHeight) {
			top -= h.offsetHeight + 20 + settings(current).top;
			helper.parent.css({top: top + 'px'}).addClass("viewport-bottom");
		}
	}
	
	function viewport() {
		return {
			x: $(window).scrollLeft(),
			y: $(window).scrollTop(),
			cx: $(window).width(),
			cy: $(window).height()
		};
	}
	
	// hide helper and restore added classes and the title
	function hide(event) {
		if($.tooltip.blocked)
			return;
		// clear timeout if possible
		if(tID)
			clearTimeout(tID);
		// no more current element
		current = null;
		
		var tsettings = settings(this);
		function complete() {
			helper.parent.removeClass( tsettings.extraClass ).hide().css("opacity", "");
		}
		if ((!IE || !$.fn.bgiframe) && tsettings.fade) {
			if (helper.parent.is(':animated'))
				helper.parent.stop().fadeTo(tsettings.fade, 0, complete);
			else
				helper.parent.stop().fadeOut(tsettings.fade, complete);
		} else
			complete();
		
		if( settings(this).fixPNG )
			helper.parent.unfixPNG();
	}
	
})(jQuery);


/* Copyright (c) 2007 Paul Bakaus (paul.bakaus@googlemail.com) and Brandon Aaron (brandon.aaron@gmail.com || http://brandonaaron.net)
 * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php)
 * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses.
 *
 * $LastChangedDate: 2007-12-20 08:46:55 -0600 (Thu, 20 Dec 2007) $
 * $Rev: 4259 $
 *
 * Version: 1.2
 *
 * Requires: jQuery 1.2+
 */

(function($){
	
$.dimensions = {
	version: '1.2'
};

// Create innerHeight, innerWidth, outerHeight and outerWidth methods
$.each( [ 'Height', 'Width' ], function(i, name){
	
	// innerHeight and innerWidth
	$.fn[ 'inner' + name ] = function() {
		if (!this[0]) return;
		
		var torl = name == 'Height' ? 'Top'    : 'Left',  // top or left
		    borr = name == 'Height' ? 'Bottom' : 'Right'; // bottom or right
		
		return this.is(':visible') ? this[0]['client' + name] : num( this, name.toLowerCase() ) + num(this, 'padding' + torl) + num(this, 'padding' + borr);
	};
	
	// outerHeight and outerWidth
	$.fn[ 'outer' + name ] = function(options) {
		if (!this[0]) return;
		
		var torl = name == 'Height' ? 'Top'    : 'Left',  // top or left
		    borr = name == 'Height' ? 'Bottom' : 'Right'; // bottom or right
		
		options = $.extend({ margin: false }, options || {});
		
		var val = this.is(':visible') ? 
				this[0]['offset' + name] : 
				num( this, name.toLowerCase() )
					+ num(this, 'border' + torl + 'Width') + num(this, 'border' + borr + 'Width')
					+ num(this, 'padding' + torl) + num(this, 'padding' + borr);
		
		return val + (options.margin ? (num(this, 'margin' + torl) + num(this, 'margin' + borr)) : 0);
	};
});

// Create scrollLeft and scrollTop methods
$.each( ['Left', 'Top'], function(i, name) {
	$.fn[ 'scroll' + name ] = function(val) {
		if (!this[0]) return;
		
		return val != undefined ?
		
			// Set the scroll offset
			this.each(function() {
				this == window || this == document ?
					window.scrollTo( 
						name == 'Left' ? val : $(window)[ 'scrollLeft' ](),
						name == 'Top'  ? val : $(window)[ 'scrollTop'  ]()
					) :
					this[ 'scroll' + name ] = val;
			}) :
			
			// Return the scroll offset
			this[0] == window || this[0] == document ?
				self[ (name == 'Left' ? 'pageXOffset' : 'pageYOffset') ] ||
					$.boxModel && document.documentElement[ 'scroll' + name ] ||
					document.body[ 'scroll' + name ] :
				this[0][ 'scroll' + name ];
	};
});

$.fn.extend({
	position: function() {
		var left = 0, top = 0, elem = this[0], offset, parentOffset, offsetParent, results;
		
		if (elem) {
			// Get *real* offsetParent
			offsetParent = this.offsetParent();
			
			// Get correct offsets
			offset       = this.offset();
			parentOffset = offsetParent.offset();
			
			// Subtract element margins
			offset.top  -= num(elem, 'marginTop');
			offset.left -= num(elem, 'marginLeft');
			
			// Add offsetParent borders
			parentOffset.top  += num(offsetParent, 'borderTopWidth');
			parentOffset.left += num(offsetParent, 'borderLeftWidth');
			
			// Subtract the two offsets
			results = {
				top:  offset.top  - parentOffset.top,
				left: offset.left - parentOffset.left
			};
		}
		
		return results;
	},
	
	offsetParent: function() {
		var offsetParent = this[0].offsetParent;
		while ( offsetParent && (!/^body|html$/i.test(offsetParent.tagName) && $.css(offsetParent, 'position') == 'static') )
			offsetParent = offsetParent.offsetParent;
		return $(offsetParent);
	}
});

function num(el, prop) {
	return parseInt($.curCSS(el.jquery?el[0]:el,prop,true))||0;
};

})(jQuery);


/*
 * JCarouselLite 1.0.1
 *
 * v1 - standard carousel
 * v2 - standard + pause on hover
 * v3 - standard + pause on hover + interval reset on nav click
 *
 */

//(function($){$.fn.jCarouselLite=function(o){o=$.extend({btnPrev:null,btnNext:null,btnGo:null,mouseWheel:false,auto:null,speed:200,easing:null,vertical:false,circular:true,visible:3,start:0,scroll:1,beforeStart:null,afterEnd:null},o||{});return this.each(function(){var b=false,animCss=o.vertical?"top":"left",sizeCss=o.vertical?"height":"width";var c=$(this),ul=$("ul",c),tLi=$("li",ul),tl=tLi.size(),v=o.visible;if(o.circular){ul.prepend(tLi.slice(tl-v-1+1).clone()).append(tLi.slice(0,v).clone());o.start+=v}var f=$("li",ul),itemLength=f.size(),curr=o.start;c.css("visibility","visible");f.css({overflow:"hidden",float:o.vertical?"none":"left"});ul.css({margin:"0",padding:"0",position:"relative","list-style-type":"none","z-index":"1"});c.css({overflow:"hidden",position:"relative","z-index":"2",left:"0px"});var g=o.vertical?height(f):width(f);var h=g*itemLength;var j=g*v;f.css({width:f.width(),height:f.height()});ul.css(sizeCss,h+"px").css(animCss,-(curr*g));c.css(sizeCss,j+"px");if(o.btnPrev)$(o.btnPrev).click(function(){return go(curr-o.scroll)});if(o.btnNext)$(o.btnNext).click(function(){return go(curr+o.scroll)});if(o.btnGo)$.each(o.btnGo,function(i,a){$(a).click(function(){return go(o.circular?o.visible+i:i)})});if(o.mouseWheel&&c.mousewheel)c.mousewheel(function(e,d){return d>0?go(curr-o.scroll):go(curr+o.scroll)});if(o.auto)setInterval(function(){go(curr+o.scroll)},o.auto+o.speed);function vis(){return f.slice(curr).slice(0,v)};function go(a){if(!b){if(o.beforeStart)o.beforeStart.call(this,vis());if(o.circular){if(a<=o.start-v-1){ul.css(animCss,-((itemLength-(v*2))*g)+"px");curr=a==o.start-v-1?itemLength-(v*2)-1:itemLength-(v*2)-o.scroll}else if(a>=itemLength-v+1){ul.css(animCss,-((v)*g)+"px");curr=a==itemLength-v+1?v+1:v+o.scroll}else curr=a}else{if(a<0||a>itemLength-v)return;else curr=a}b=true;ul.animate(animCss=="left"?{left:-(curr*g)}:{top:-(curr*g)},o.speed,o.easing,function(){if(o.afterEnd)o.afterEnd.call(this,vis());b=false});if(!o.circular){$(o.btnPrev+","+o.btnNext).removeClass("disabled");$((curr-o.scroll<0&&o.btnPrev)||(curr+o.scroll>itemLength-v&&o.btnNext)||[]).addClass("disabled")}}return false}})};function css(a,b){return parseInt($.css(a[0],b))||0};function width(a){return a[0].offsetWidth+css(a,'marginLeft')+css(a,'marginRight')};function height(a){return a[0].offsetHeight+css(a,'marginTop')+css(a,'marginBottom')}})(jQuery);
//(function($){$.fn.jCarouselLite=function(o){o=$.extend({btnPrev:null,btnNext:null,btnGo:null,mouseWheel:false,auto:null,speed:200,easing:null,vertical:false,circular:true,visible:3,start:0,scroll:1,pauseOnHover:false,beforeStart:null,afterEnd:null},o||{});return this.each(function(){var running=false,animCss=o.vertical?"top":"left",sizeCss=o.vertical?"height":"width";var div=$(this),ul=$("ul",div),tLi=$("li",ul),tl=tLi.size(),v=o.visible,paused=0;if(o.circular){ul.prepend(tLi.slice(tl-v-1+1).clone()).append(tLi.slice(0,v).clone());o.start+=v}o.pauseOnHover?ul.hover(function(){paused=1},function(){paused=0}):"";var li=$("li",ul),itemLength=li.size(),curr=o.start;div.css("visibility","visible");li.css({overflow:"hidden","float":o.vertical?"none":"left"});ul.css({margin:"0",padding:"0",position:"relative","list-style-type":"none","z-index":"1"});div.css({overflow:"hidden",position:"relative","z-index":"2",left:"0px"});var liSize=o.vertical?height(li):width(li);var ulSize=liSize*itemLength;var divSize=liSize*v;li.css({width:li.width(),height:li.height()});ul.css(sizeCss,ulSize+"px").css(animCss,-(curr*liSize));div.css(sizeCss,divSize+"px");if(o.btnPrev){$(o.btnPrev).click(function(){return go(curr-o.scroll)})}if(o.btnNext){$(o.btnNext).click(function(){return go(curr+o.scroll)})}if(o.btnGo){$.each(o.btnGo,function(i,val){$(val).click(function(){return go(o.circular?o.visible+i:i)})})}if(o.mouseWheel&&div.mousewheel){div.mousewheel(function(e,d){return d>0?go(curr-o.scroll):go(curr+o.scroll)})}if(o.auto){setInterval(function(){go(curr+o.scroll)},o.auto+o.speed)}function vis(){return li.slice(curr).slice(0,v)}function go(to){if(!running&&!paused){if(o.beforeStart){o.beforeStart.call(this,vis())}if(o.circular){if(to<=o.start-v-1){ul.css(animCss,-((itemLength-(v*2))*liSize)+"px");curr=to==o.start-v-1?itemLength-(v*2)-1:itemLength-(v*2)-o.scroll}else{if(to>=itemLength-v+1){ul.css(animCss,-((v)*liSize)+"px");curr=to==itemLength-v+1?v+1:v+o.scroll}else{curr=to}}}else{if(to<0||to>itemLength-v){return}else{curr=to}}running=true;ul.animate(animCss=="left"?{left:-(curr*liSize)}:{top:-(curr*liSize)},o.speed,o.easing,function(){if(o.afterEnd){o.afterEnd.call(this,vis())}running=false});if(!o.circular){$(o.btnPrev+","+o.btnNext).removeClass("disabled");$((curr-o.scroll<0&&o.btnPrev)||(curr+o.scroll>itemLength-v&&o.btnNext)||[]).addClass("disabled")}}return false}})};function css(el,prop){return parseInt($.css(el[0],prop))||0}function width(el){return el[0].offsetWidth+css(el,"marginLeft")+css(el,"marginRight")}function height(el){return el[0].offsetHeight+css(el,"marginTop")+css(el,"marginBottom")}})(jQuery);
(function($){$.fn.jCarouselLite=function(o){o=$.extend({btnPrev:null,btnNext:null,btnGo:null,mouseWheel:false,auto:null,speed:200,easing:null,vertical:false,circular:true,visible:3,start:0,scroll:1,pauseOnHover:false,beforeStart:null,afterEnd:null},o||{});return this.each(function(){var running=false,animCss=o.vertical?"top":"left",sizeCss=o.vertical?"height":"width";var div=$(this),ul=$("ul",div),tLi=$("li",ul),tl=tLi.size(),v=o.visible,paused=0;if(o.circular){ul.prepend(tLi.slice(tl-v-1+1).clone()).append(tLi.slice(0,v).clone());o.start+=v}o.pauseOnHover?ul.hover(function(){paused=1},function(){paused=0}):"";var li=$("li",ul),itemLength=li.size(),curr=o.start;div.css("visibility","visible");li.css({overflow:"hidden","float":o.vertical?"none":"left"});ul.css({margin:"0",padding:"0",position:"relative","list-style-type":"none","z-index":"1"});div.css({overflow:"hidden",position:"relative","z-index":"2",left:"0px"});var liSize=o.vertical?height(li):width(li);var ulSize=liSize*itemLength;var divSize=liSize*v;li.css({width:li.width(),height:li.height()});ul.css(sizeCss,ulSize+"px").css(animCss,-(curr*liSize));div.css(sizeCss,divSize+"px");if(o.btnPrev){$(o.btnPrev).click(function(){if(o.auto){clearInterval(autoInterval);autoInterval = setInterval(function() {go(curr+o.scroll);}, o.auto+o.speed);}return go(curr-o.scroll)})}if(o.btnNext){$(o.btnNext).click(function(){if(o.auto){clearInterval(autoInterval);autoInterval = setInterval(function() {go(curr+o.scroll);}, o.auto+o.speed);}return go(curr+o.scroll)})}if(o.btnGo){$.each(o.btnGo,function(i,val){$(val).click(function(){if(o.auto){clearInterval(autoInterval);autoInterval = setInterval(function() {go(curr+o.scroll);}, o.auto+o.speed);}return go(o.circular?o.visible+i:i)})})}if(o.mouseWheel&&div.mousewheel){div.mousewheel(function(e,d){return d>0?go(curr-o.scroll):go(curr+o.scroll)})}if(o.auto){autoInterval=setInterval(function(){go(curr+o.scroll)},o.auto+o.speed)}function vis(){return li.slice(curr).slice(0,v)}function go(to){if(!running&&!paused){if(o.beforeStart){o.beforeStart.call(this,vis())}if(o.circular){if(to<=o.start-v-1){ul.css(animCss,-((itemLength-(v*2))*liSize)+"px");curr=to==o.start-v-1?itemLength-(v*2)-1:itemLength-(v*2)-o.scroll}else{if(to>=itemLength-v+1){ul.css(animCss,-((v)*liSize)+"px");curr=to==itemLength-v+1?v+1:v+o.scroll}else{curr=to}}}else{if(to<0||to>itemLength-v){return}else{curr=to}}running=true;ul.animate(animCss=="left"?{left:-(curr*liSize)}:{top:-(curr*liSize)},o.speed,o.easing,function(){if(o.afterEnd){o.afterEnd.call(this,vis())}running=false});if(!o.circular){$(o.btnPrev+","+o.btnNext).removeClass("disabled");$((curr-o.scroll<0&&o.btnPrev)||(curr+o.scroll>itemLength-v&&o.btnNext)||[]).addClass("disabled")}}return false}})};function css(el,prop){return parseInt($.css(el[0],prop))||0}function width(el){return el[0].offsetWidth+css(el,"marginLeft")+css(el,"marginRight")}function height(el){return el[0].offsetHeight+css(el,"marginTop")+css(el,"marginBottom")}})(jQuery);


/**JScrollPane***/
//(function(A){A.jScrollPane={active:[]};A.fn.jScrollPane=function(C){C=A.extend({},A.fn.jScrollPane.defaults,C);var B=function(){return false};return this.each(function(){var O=A(this);O.css("overflow","hidden");var X=this;if(A(this).parent().is(".jScrollPaneContainer")){var Ac=C.maintainPosition?O.position().top:0;var L=A(this).parent();var d=L.innerWidth();var Ad=L.outerHeight();var M=Ad;A(">.jScrollPaneTrack, >.jScrollArrowUp, >.jScrollArrowDown",L).remove();O.css({top:0})}else{var Ac=0;this.originalPadding=O.css("paddingTop")+" "+O.css("paddingRight")+" "+O.css("paddingBottom")+" "+O.css("paddingLeft");this.originalSidePaddingTotal=(parseInt(O.css("paddingLeft"))||0)+(parseInt(O.css("paddingRight"))||0);var d=O.innerWidth();var Ad=O.innerHeight();var M=Ad;O.wrap(A("<div></div>").attr({className:"jScrollPaneContainer"}).css({height:Ad+"px",width:d+"px"}));A(document).bind("emchange",function(Ae,Af,p){O.jScrollPane(C)})}if(C.reinitialiseOnImageLoad){var N=A.data(X,"jScrollPaneImagesToLoad")||A("img",O);var G=[];if(N.length){N.each(function(p,Ae){A(this).bind("load",function(){if(A.inArray(p,G)==-1){G.push(Ae);N=A.grep(N,function(Ag,Af){return Ag!=Ae});A.data(X,"jScrollPaneImagesToLoad",N);C.reinitialiseOnImageLoad=false;O.jScrollPane(C)}}).each(function(Af,Ag){if(this.complete||this.complete===undefined){this.src=this.src}})})}}var o=this.originalSidePaddingTotal;var l={height:"auto",width:d-C.scrollbarWidth-C.scrollbarMargin-o+"px"};if(C.scrollbarOnLeft){l.paddingLeft=C.scrollbarMargin+C.scrollbarWidth+"px"}else{l.paddingRight=C.scrollbarMargin+"px"}O.css(l);var m=O.outerHeight();var i=Ad/m;if(i<0.99){var H=O.parent();H.append(A("<div></div>").attr({className:"jScrollPaneTrack"}).css({width:C.scrollbarWidth+"px"}).append(A("<div></div>").attr({className:"jScrollPaneDrag"}).css({width:C.scrollbarWidth+"px"}).append(A("<div></div>").attr({className:"jScrollPaneDragTop"}).css({width:C.scrollbarWidth+"px"}),A("<div></div>").attr({className:"jScrollPaneDragBottom"}).css({width:C.scrollbarWidth+"px"}))));var z=A(">.jScrollPaneTrack",H);var P=A(">.jScrollPaneTrack .jScrollPaneDrag",H);if(C.showArrows){var g;var Ab;var S;var r;var j=function(){if(r>4||r%4==0){y(u+Ab*b)}r++};var K=function(p){A("html").unbind("mouseup",K);g.removeClass("jScrollActiveArrowButton");clearInterval(S)};var Z=function(){A("html").bind("mouseup",K);g.addClass("jScrollActiveArrowButton");r=0;j();S=setInterval(j,100)};H.append(A("<a></a>").attr({href:"javascript:;",className:"jScrollArrowUp"}).css({width:C.scrollbarWidth+"px"}).html("Scroll up").bind("mousedown",function(){g=A(this);Ab=-1;Z();this.blur();return false}).bind("click",B),A("<a></a>").attr({href:"javascript:;",className:"jScrollArrowDown"}).css({width:C.scrollbarWidth+"px"}).html("Scroll down").bind("mousedown",function(){g=A(this);Ab=1;Z();this.blur();return false}).bind("click",B));var Q=A(">.jScrollArrowUp",H);var J=A(">.jScrollArrowDown",H);if(C.arrowSize){M=Ad-C.arrowSize-C.arrowSize;z.css({height:M+"px",top:C.arrowSize+"px"})}else{var s=Q.height();C.arrowSize=s;M=Ad-s-J.height();z.css({height:M+"px",top:s+"px"})}}var w=A(this).css({position:"absolute",overflow:"visible"});var D;var Y;var b;var u=0;var V=i*Ad/2;var a=function(Ae,Ag){var Af=Ag=="X"?"Left":"Top";return Ae["page"+Ag]||(Ae["client"+Ag]+(document.documentElement["scroll"+Af]||document.body["scroll"+Af]))||0};var f=function(){return false};var v=function(){n();D=P.offset(false);D.top-=u;Y=M-P[0].offsetHeight;b=2*C.wheelSpeed*Y/m};var E=function(p){v();V=a(p,"Y")-u-D.top;A("html").bind("mouseup",T).bind("mousemove",h);if(A.browser.msie){A("html").bind("dragstart",f).bind("selectstart",f)}return false};var T=function(){A("html").unbind("mouseup",T).unbind("mousemove",h);V=i*Ad/2;if(A.browser.msie){A("html").unbind("dragstart",f).unbind("selectstart",f)}};var y=function(Ae){Ae=Ae<0?0:(Ae>Y?Y:Ae);u=Ae;P.css({top:Ae+"px"});var Af=Ae/Y;w.css({top:((Ad-m)*Af)+"px"});O.trigger("scroll");if(C.showArrows){Q[Ae==0?"addClass":"removeClass"]("disabled");J[Ae==Y?"addClass":"removeClass"]("disabled")}};var h=function(p){y(a(p,"Y")-D.top-V)};var q=Math.max(Math.min(i*(Ad-C.arrowSize*2),C.dragMaxHeight),C.dragMinHeight);P.css({height:q+"px"}).bind("mousedown",E);var k;var R;var I;var t=function(){if(R>8||R%4==0){y((u-((u-I)/2)))}R++};var Aa=function(){clearInterval(k);A("html").unbind("mouseup",Aa).unbind("mousemove",e)};var e=function(p){I=a(p,"Y")-D.top-V};var U=function(p){v();e(p);R=0;A("html").bind("mouseup",Aa).bind("mousemove",e);k=setInterval(t,100);t()};z.bind("mousedown",U);H.bind("mousewheel",function(Ae,Ag){v();n();var Af=u;y(u-Ag*b);var p=Af!=u;return !p});var F;var W;function c(){var p=(F-u)/C.animateStep;if(p>1||p<-1){y(u+p)}else{y(F);n()}}var n=function(){if(W){clearInterval(W);delete F}};var x=function(Af,p){if(typeof Af=="string"){$e=A(Af,O);if(!$e.length){return}Af=$e.offset().top-O.offset().top}H.scrollTop(0);n();var Ae=-Af/(Ad-m)*Y;if(p||!C.animateTo){y(Ae)}else{F=Ae;W=setInterval(c,C.animateInterval)}};O[0].scrollTo=x;O[0].scrollBy=function(Ae){var p=-parseInt(w.css("top"))||0;x(p+Ae)};v();x(-Ac,true);A("*",this).bind("focus",function(Ah){var Ag=A(this);var Aj=0;while(Ag[0]!=O[0]){Aj+=Ag.position().top;Ag=Ag.offsetParent()}var p=-parseInt(w.css("top"))||0;var Ai=p+Ad;var Af=Aj>p&&Aj<Ai;if(!Af){var Ae=Aj-C.scrollbarMargin;if(Aj>p){Ae+=A(this).height()+15+C.scrollbarMargin-Ad}x(Ae)}});if(location.hash){x(location.hash)}A(document).bind("click",function(Ae){$target=A(Ae.target);if($target.is("a")){var p=$target.attr("href");if(p.substr(0,1)=="#"){x(p)}}});A.jScrollPane.active.push(O[0])}else{O.css({height:Ad+"px",width:d-this.originalSidePaddingTotal+"px",padding:this.originalPadding});O.parent().unbind("mousewheel")}})};A.fn.jScrollPane.defaults={scrollbarWidth:10,scrollbarMargin:5,wheelSpeed:18,showArrows:false,arrowSize:0,animateTo:false,dragMinHeight:1,dragMaxHeight:99999,animateInterval:100,animateStep:3,maintainPosition:true,scrollbarOnLeft:false,reinitialiseOnImageLoad:false};A(window).bind("unload",function(){var C=A.jScrollPane.active;for(var B=0;B<C.length;B++){C[B].scrollTo=C[B].scrollBy=null}})})(jQuery);

/* Copyright (c) 2009 Kelvin Luck (kelvin AT kelvinluck DOT com || http://www.kelvinluck.com)
 * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php)
 * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses.
 *
 * See http://kelvinluck.com/assets/jquery/jScrollPane/
 * $Id$
 */

/**
 * Replace the vertical scroll bars on any matched elements with a fancy
 * styleable (via CSS) version. With JS disabled the elements will
 * gracefully degrade to the browsers own implementation of overflow:auto.
 * If the mousewheel plugin has been included on the page then the scrollable areas will also
 * respond to the mouse wheel.
 *
 * @example jQuery(".scroll-pane").jScrollPane();
 *
 * @name jScrollPane
 * @type jQuery
 * @param Object        settings        hash with options, described below.
 *                                                              scrollbarWidth  -       The width of the generated scrollbar in pixels
 *                                                              scrollbarMargin -       The amount of space to leave on the side of the scrollbar in pixels
 *                                                              wheelSpeed              -       The speed the pane will scroll in response to the mouse wheel in pixels
 *                                                              showArrows              -       Whether to display arrows for the user to scroll with
 *                                                              arrowSize               -       The height of the arrow buttons if showArrows=true
 *                                                              animateTo               -       Whether to animate when calling scrollTo and scrollBy
 *                                                              dragMinHeight   -       The minimum height to allow the drag bar to be
 *                                                              dragMaxHeight   -       The maximum height to allow the drag bar to be
 *                                                              animateInterval -       The interval in milliseconds to update an animating scrollPane (default 100)
 *                                                              animateStep             -       The amount to divide the remaining scroll distance by when animating (default 3)
 *                                                              maintainPosition-       Whether you want the contents of the scroll pane to maintain it's position when you re-initialise it - so it doesn't scroll as you add more content (default true)
 *                                                              tabIndex                -       The tabindex for this jScrollPane to control when it is tabbed to when navigating via keyboard (default 0)
 *                                                              enableKeyboardNavigation - Whether to allow keyboard scrolling of this jScrollPane when it is focused (default true)
 *                                                              animateToInternalLinks - Whether the move to an internal link (e.g. when it's focused by tabbing or by a hash change in the URL) should be animated or instant (default false)
 *                                                              scrollbarOnLeft -       Display the scrollbar on the left side?  (needs stylesheet changes, see examples.html)
 *                                                              reinitialiseOnImageLoad - Whether the jScrollPane should automatically re-initialise itself when any contained images are loaded (default false)
 *                                                              topCapHeight    -       The height of the "cap" area between the top of the jScrollPane and the top of the track/ buttons
 *                                                              bottomCapHeight -       The height of the "cap" area between the bottom of the jScrollPane and the bottom of the track/ buttons
 *                                                              observeHash             -       Whether jScrollPane should attempt to automagically scroll to the correct place when an anchor inside the scrollpane is linked to (default true)
 * @return jQuery
 * @cat Plugins/jScrollPane
 * @author Kelvin Luck (kelvin AT kelvinluck DOT com || http://www.kelvinluck.com)
 */

(function($) {

$.jScrollPane = {
        active : []
};
$.fn.jScrollPane = function(settings)
{
        settings = $.extend({}, $.fn.jScrollPane.defaults, settings);

        var rf = function() { return false; };
       
        return this.each(
                function()
                {
                        var $this = $(this);
                        var paneEle = this;
                        var currentScrollPosition = 0;
                        var paneWidth;
                        var paneHeight;
                        var trackHeight;
                        var trackOffset = settings.topCapHeight;
                        var $container;
                       
                        if ($(this).parent().is('.jScrollPaneContainer')) {
                                $container = $(this).parent();
                                currentScrollPosition = settings.maintainPosition ? $this.position().top : 0;
                                var $c = $(this).parent();
                                paneWidth = $c.innerWidth();
                                paneHeight = $c.outerHeight();
                                $('>.jScrollPaneTrack, >.jScrollArrowUp, >.jScrollArrowDown, >.jScrollCap', $c).remove();
                                $this.css({'top':0});
                        } else {
                                $this.data('originalStyleTag', $this.attr('style'));
                                // Switch the element's overflow to hidden to ensure we get the size of the element without the scrollbars [http://plugins.jquery.com/node/1208]
                                $this.css('overflow', 'hidden');
                                this.originalPadding = $this.css('paddingTop') + ' ' + $this.css('paddingRight') + ' ' + $this.css('paddingBottom') + ' ' + $this.css('paddingLeft');
                                this.originalSidePaddingTotal = (parseInt($this.css('paddingLeft')) || 0) + (parseInt($this.css('paddingRight')) || 0);
                                paneWidth = $this.innerWidth();
                                paneHeight = $this.innerHeight();
                                $container = $('<div></div>')
                                        .attr({'className':'jScrollPaneContainer'})
                                        .css(
                                                {
                                                        'height':paneHeight+'px',
                                                        'width':paneWidth+'px'
                                                }
                                        );
                                if (settings.enableKeyboardNavigation) {
                                        $container.attr(
                                                'tabindex',
                                                settings.tabIndex
                                        );
                                }
                                $this.wrap($container);
                                $container = $this.parent();
                                // deal with text size changes (if the jquery.em plugin is included)
                                // and re-initialise the scrollPane so the track maintains the
                                // correct size
                                $(document).bind(
                                        'emchange',
                                        function(e, cur, prev)
                                        {
                                                $this.jScrollPane(settings);
                                        }
                                );
                               
                        }
                        trackHeight = paneHeight;
                       
                        if (settings.reinitialiseOnImageLoad) {
                                // code inspired by jquery.onImagesLoad: http://plugins.jquery.com/project/onImagesLoad
                                // except we re-initialise the scroll pane when each image loads so that the scroll pane is always up to size...
                                // TODO: Do I even need to store it in $.data? Is a local variable here the same since I don't pass the reinitialiseOnImageLoad when I re-initialise?
                                var $imagesToLoad = $.data(paneEle, 'jScrollPaneImagesToLoad') || $('img', $this);
                                var loadedImages = [];
                               
                                if ($imagesToLoad.length) {
                                        $imagesToLoad.each(function(i, val)     {
                                                $(this).bind('load readystatechange', function() {
                                                        if($.inArray(i, loadedImages) == -1){ //don't double count images
                                                                loadedImages.push(val); //keep a record of images we've seen
                                                                $imagesToLoad = $.grep($imagesToLoad, function(n, i) {
                                                                        return n != val;
                                                                });
                                                                $.data(paneEle, 'jScrollPaneImagesToLoad', $imagesToLoad);
                                                                var s2 = $.extend(settings, {reinitialiseOnImageLoad:false});
                                                                $this.jScrollPane(s2); // re-initialise
                                                        }
                                                }).each(function(i, val) {
                                                        if(this.complete || this.complete===undefined) {
                                                                //needed for potential cached images
                                                                this.src = this.src;
                                                        }
                                                });
                                        });
                                };
                        }

                        var p = this.originalSidePaddingTotal;
                        var realPaneWidth = paneWidth - settings.scrollbarWidth - settings.scrollbarMargin - p;

                        var cssToApply = {
                                'height':'auto',
                                'width': realPaneWidth + 'px'
                        }

                        if(settings.scrollbarOnLeft) {
                                cssToApply.paddingLeft = settings.scrollbarMargin + settings.scrollbarWidth + 'px';
                        } else {
                                cssToApply.paddingRight = settings.scrollbarMargin + 'px';
                        }

                        $this.css(cssToApply);

                        var contentHeight = $this.outerHeight();
                        var percentInView = paneHeight / contentHeight;
                       
                        var isScrollable = percentInView < .99;
                        $container[isScrollable ? 'addClass' : 'removeClass']('jScrollPaneScrollable');

                        if (isScrollable) {
                                $container.append(
                                        $('<div></div>').addClass('jScrollCap jScrollCapTop').css({height:settings.topCapHeight}),
                                        $('<div></div>').attr({'className':'jScrollPaneTrack'}).css({'width':settings.scrollbarWidth+'px'}).append(
                                                $('<div></div>').attr({'className':'jScrollPaneDrag'}).css({'width':settings.scrollbarWidth+'px'}).append(
                                                        $('<div></div>').attr({'className':'jScrollPaneDragTop'}).css({'width':settings.scrollbarWidth+'px'}),
                                                        $('<div></div>').attr({'className':'jScrollPaneDragBottom'}).css({'width':settings.scrollbarWidth+'px'})
                                                )
                                        ),
                                        $('<div></div>').addClass('jScrollCap jScrollCapBottom').css({height:settings.bottomCapHeight})
                                );
                               
                                var $track = $('>.jScrollPaneTrack', $container);
                                var $drag = $('>.jScrollPaneTrack .jScrollPaneDrag', $container);
                               
                               
                                var currentArrowDirection;
                                var currentArrowTimerArr = [];// Array is used to store timers since they can stack up when dealing with keyboard events. This ensures all timers are cleaned up in the end, preventing an acceleration bug.
                                var currentArrowInc;
                                var whileArrowButtonDown = function()
                                {
                                        if (currentArrowInc > 4 || currentArrowInc % 4 == 0) {
                                                positionDrag(dragPosition + currentArrowDirection * mouseWheelMultiplier);
                                        }
                                        currentArrowInc++;
                                };

                                if (settings.enableKeyboardNavigation) {
                                        $container.bind(
                                                'keydown.jscrollpane',
                                                function(e)
                                                {
                                                        switch (e.keyCode) {
                                                                case 38: //up
                                                                        currentArrowDirection = -1;
                                                                        currentArrowInc = 0;
                                                                        whileArrowButtonDown();
                                                                        currentArrowTimerArr[currentArrowTimerArr.length] = setInterval(whileArrowButtonDown, 100);
                                                                        return false;
                                                                case 40: //down
                                                                        currentArrowDirection = 1;
                                                                        currentArrowInc = 0;
                                                                        whileArrowButtonDown();
                                                                        currentArrowTimerArr[currentArrowTimerArr.length] = setInterval(whileArrowButtonDown, 100);
                                                                        return false;
                                                                case 33: // page up
                                                                case 34: // page down
                                                                        // TODO
                                                                        return false;
                                                                default:
                                                        }
                                                }
                                        ).bind(
                                                'keyup.jscrollpane',
                                                function(e)
                                                {
                                                        if (e.keyCode == 38 || e.keyCode == 40) {
                                                                for (var i = 0; i < currentArrowTimerArr.length; i++) {
                                                                        clearInterval(currentArrowTimerArr[i]);
                                                                }
                                                                return false;
                                                        }
                                                }
                                        );
                                }


                                if (settings.showArrows) {
                                       
                                        var currentArrowButton;
                                        var currentArrowInterval;

                                        var onArrowMouseUp = function(event)
                                        {
                                                $('html').unbind('mouseup', onArrowMouseUp);
                                                currentArrowButton.removeClass('jScrollActiveArrowButton');
                                                clearInterval(currentArrowInterval);
                                        };
                                        var onArrowMouseDown = function() {
                                                $('html').bind('mouseup', onArrowMouseUp);
                                                currentArrowButton.addClass('jScrollActiveArrowButton');
                                                currentArrowInc = 0;
                                                whileArrowButtonDown();
                                                currentArrowInterval = setInterval(whileArrowButtonDown, 100);
                                        };
                                        $container
                                                .append(
                                                        $('<a></a>')
                                                                .attr(
                                                                        {
                                                                                'href':'javascript:;',
                                                                                'className':'jScrollArrowUp',
                                                                                'tabindex':-1
                                                                        }
                                                                )
                                                                .css(
                                                                        {
                                                                                'width':settings.scrollbarWidth+'px',
                                                                                'top':settings.topCapHeight + 'px'
                                                                        }
                                                                )
                                                                .html('Scroll up')
                                                                .bind('mousedown', function()
                                                                {
                                                                        currentArrowButton = $(this);
                                                                        currentArrowDirection = -1;
                                                                        onArrowMouseDown();
                                                                        this.blur();
                                                                        return false;
                                                                })
                                                                .bind('click', rf),
                                                        $('<a></a>')
                                                                .attr(
                                                                        {
                                                                                'href':'javascript:;',
                                                                                'className':'jScrollArrowDown',
                                                                                'tabindex':-1
                                                                        }
                                                                )
                                                                .css(
                                                                        {
                                                                                'width':settings.scrollbarWidth+'px',
                                                                                'bottom':settings.bottomCapHeight + 'px'
                                                                        }
                                                                )
                                                                .html('Scroll down')
                                                                .bind('mousedown', function()
                                                                {
                                                                        currentArrowButton = $(this);
                                                                        currentArrowDirection = 1;
                                                                        onArrowMouseDown();
                                                                        this.blur();
                                                                        return false;
                                                                })
                                                                .bind('click', rf)
                                                );
                                        var $upArrow = $('>.jScrollArrowUp', $container);
                                        var $downArrow = $('>.jScrollArrowDown', $container);
                                }
                               
                                if (settings.arrowSize) {
                                        trackHeight = paneHeight - settings.arrowSize - settings.arrowSize;
                                        trackOffset += settings.arrowSize;
                                } else if ($upArrow) {
                                        var topArrowHeight = $upArrow.height();
                                        settings.arrowSize = topArrowHeight;
                                        trackHeight = paneHeight - topArrowHeight - $downArrow.height();
                                        trackOffset += topArrowHeight;
                                }
                                trackHeight -= settings.topCapHeight + settings.bottomCapHeight;
                                $track.css({'height': trackHeight+'px', top:trackOffset+'px'})
                               
                                var $pane = $(this).css({'position':'absolute', 'overflow':'visible'});
                               
                                var currentOffset;
                                var maxY;
                                var mouseWheelMultiplier;
                                // store this in a seperate variable so we can keep track more accurately than just updating the css property..
                                var dragPosition = 0;
                                var dragMiddle = percentInView*paneHeight/2;
                               
                                // pos function borrowed from tooltip plugin and adapted...
                                var getPos = function (event, c) {
                                        var p = c == 'X' ? 'Left' : 'Top';
                                        return event['page' + c] || (event['client' + c] + (document.documentElement['scroll' + p] || document.body['scroll' + p])) || 0;
                                };
                               
                                var ignoreNativeDrag = function() {     return false; };
                               
                                var initDrag = function()
                                {
                                        ceaseAnimation();
                                        currentOffset = $drag.offset(false);
                                        currentOffset.top -= dragPosition;
                                        maxY = trackHeight - $drag[0].offsetHeight;
                                        mouseWheelMultiplier = 2 * settings.wheelSpeed * maxY / contentHeight;
                                };
                               
                                var onStartDrag = function(event)
                                {
                                        initDrag();
                                        dragMiddle = getPos(event, 'Y') - dragPosition - currentOffset.top;
                                        $('html').bind('mouseup', onStopDrag).bind('mousemove', updateScroll).bind('mouseleave', onStopDrag)
                                        if ($.browser.msie) {
                                                $('html').bind('dragstart', ignoreNativeDrag).bind('selectstart', ignoreNativeDrag);
                                        }
                                        return false;
                                };
                                var onStopDrag = function()
                                {
                                        $('html').unbind('mouseup', onStopDrag).unbind('mousemove', updateScroll);
                                        dragMiddle = percentInView*paneHeight/2;
                                        if ($.browser.msie) {
                                                $('html').unbind('dragstart', ignoreNativeDrag).unbind('selectstart', ignoreNativeDrag);
                                        }
                                };
                                var positionDrag = function(destY)
                                {
                                        $container.scrollTop(0);
                                        destY = destY < 0 ? 0 : (destY > maxY ? maxY : destY);
                                        dragPosition = destY;
                                        $drag.css({'top':destY+'px'});
                                        var p = destY / maxY;
                                        $this.data('jScrollPanePosition', (paneHeight-contentHeight)*-p);
                                        $pane.css({'top':((paneHeight-contentHeight)*p) + 'px'});
                                        $this.trigger('scroll');
                                        if (settings.showArrows) {
                                                $upArrow[destY == 0 ? 'addClass' : 'removeClass']('disabled');
                                                $downArrow[destY == maxY ? 'addClass' : 'removeClass']('disabled');
                                        }
                                };
                                var updateScroll = function(e)
                                {
                                        positionDrag(getPos(e, 'Y') - currentOffset.top - dragMiddle);
                                };
                               
                                var dragH = Math.max(Math.min(percentInView*(paneHeight-settings.arrowSize*2), settings.dragMaxHeight), settings.dragMinHeight);
                               
                                $drag.css(
                                        {'height':dragH+'px'}
                                ).bind('mousedown', onStartDrag);
                               
                                var trackScrollInterval;
                                var trackScrollInc;
                                var trackScrollMousePos;
                                var doTrackScroll = function()
                                {
                                        if (trackScrollInc > 8 || trackScrollInc%4==0) {
                                                positionDrag((dragPosition - ((dragPosition - trackScrollMousePos) / 2)));
                                        }
                                        trackScrollInc ++;
                                };
                                var onStopTrackClick = function()
                                {
                                        clearInterval(trackScrollInterval);
                                        $('html').unbind('mouseup', onStopTrackClick).unbind('mousemove', onTrackMouseMove);
                                };
                                var onTrackMouseMove = function(event)
                                {
                                        trackScrollMousePos = getPos(event, 'Y') - currentOffset.top - dragMiddle;
                                };
                                var onTrackClick = function(event)
                                {
                                        initDrag();
                                        onTrackMouseMove(event);
                                        trackScrollInc = 0;
                                        $('html').bind('mouseup', onStopTrackClick).bind('mousemove', onTrackMouseMove);
                                        trackScrollInterval = setInterval(doTrackScroll, 100);
                                        doTrackScroll();
                                        return false;
                                };
                               
                                $track.bind('mousedown', onTrackClick);
                               
                                $container.bind(
                                        'mousewheel',
                                        function (event, delta) {
                                                delta = delta || (event.wheelDelta ? event.wheelDelta / 120 : (event.detail) ?
-event.detail/3 : 0);
                                                initDrag();
                                                ceaseAnimation();
                                                var d = dragPosition;
                                                positionDrag(dragPosition - delta * mouseWheelMultiplier);
                                                var dragOccured = d != dragPosition;
                                                return !dragOccured;
                                        }
                                );


                                var _animateToPosition;
                                var _animateToInterval;
                                function animateToPosition()
                                {
                                        var diff = (_animateToPosition - dragPosition) / settings.animateStep;
                                        if (diff > 1 || diff < -1) {
                                                positionDrag(dragPosition + diff);
                                        } else {
                                                positionDrag(_animateToPosition);
                                                ceaseAnimation();
                                        }
                                }
                                var ceaseAnimation = function()
                                {
                                        if (_animateToInterval) {
                                                clearInterval(_animateToInterval);
                                                delete _animateToPosition;
                                        }
                                };
                                var scrollTo = function(pos, preventAni)
                                {
                                        if (typeof pos == "string") {
                                                // Legal hash values aren't necessarily legal jQuery selectors so we need to catch any
                                                // errors from the lookup...
                                                try {
                                                        $e = $(pos, $this);
                                                } catch (err) {
                                                        return;
                                                }
                                                if (!$e.length) return;
                                                pos = $e.offset().top - $this.offset().top;
                                        }
                                        ceaseAnimation();
                                        var maxScroll = contentHeight - paneHeight;
                                        pos = pos > maxScroll ? maxScroll : pos;
                                        $this.data('jScrollPaneMaxScroll', maxScroll);
                                        var destDragPosition = pos/maxScroll * maxY;
                                        if (preventAni || !settings.animateTo) {
                                                positionDrag(destDragPosition);
                                        } else {
                                                $container.scrollTop(0);
                                                _animateToPosition = destDragPosition;
                                                _animateToInterval = setInterval(animateToPosition, settings.animateInterval);
                                        }
                                };
                                $this[0].scrollTo = scrollTo;
                               
                                $this[0].scrollBy = function(delta)
                                {
                                        var currentPos = -parseInt($pane.css('top')) || 0;
                                        scrollTo(currentPos + delta);
                                };
                               
                                initDrag();
                               
                                scrollTo(-currentScrollPosition, true);
                       
                                // Deal with it when the user tabs to a link or form element within this scrollpane
                                $('*', this).bind(
                                        'focus',
                                        function(event)
                                        {
                                                var $e = $(this);
                                               
                                                // loop through parents adding the offset top of any elements that are relatively positioned between
                                                // the focused element and the jScrollPaneContainer so we can get the true distance from the top
                                                // of the focused element to the top of the scrollpane...
                                                var eleTop = 0;
                                               
                                                var preventInfiniteLoop = 100;
                                               
                                                while ($e[0] != $this[0]) {
                                                        eleTop += $e.position().top;
                                                        $e = $e.offsetParent();
                                                        if (!preventInfiniteLoop--) {
                                                                return;
                                                        }
                                                }
                                               
                                                var viewportTop = -parseInt($pane.css('top')) || 0;
                                                var maxVisibleEleTop = viewportTop + paneHeight;
                                                var eleInView = eleTop > viewportTop && eleTop < maxVisibleEleTop;
                                                if (!eleInView) {
                                                        var destPos = eleTop - settings.scrollbarMargin;
                                                        if (eleTop > viewportTop) { // element is below viewport - scroll so it is at bottom.
                                                                destPos += $(this).height() + 15 + settings.scrollbarMargin - paneHeight;
                                                        }
                                                        scrollTo(destPos);
                                                }
                                        }
                                )
                               
                               
                                if (settings.observeHash) {
                                        if (location.hash && location.hash.length > 1) {
                                                setTimeout(function(){
                                                        scrollTo(location.hash);
                                                }, $.browser.safari ? 100 : 0);
                                        }
                                       
                                        // use event delegation to listen for all clicks on links and hijack them if they are links to
                                        // anchors within our content...
                                        $(document).bind('click', function(e){
                                                $target = $(e.target);
                                                if ($target.is('a')) {
                                                        var h = $target.attr('href');
                                                        if (h && h.substr(0, 1) == '#' && h.length > 1) {
                                                                setTimeout(function(){
                                                                        scrollTo(h, !settings.animateToInternalLinks);
                                                                }, $.browser.safari ? 100 : 0);
                                                        }
                                                }
                                        });
                                }
                               
                                // Deal with dragging and selecting text to make the scrollpane scroll...
                                function onSelectScrollMouseDown(e)
                                {
                                   $(document).bind('mousemove.jScrollPaneDragging', onTextSelectionScrollMouseMove);
                                   $(document).bind('mouseup.jScrollPaneDragging',   onSelectScrollMouseUp);
                                 
                                }
                               
                                var textDragDistanceAway;
                                var textSelectionInterval;
                               
                                function onTextSelectionInterval()
                                {
                                        direction = textDragDistanceAway < 0 ? -1 : 1;
                                        $this[0].scrollBy(textDragDistanceAway / 2);
                                }

                                function clearTextSelectionInterval()
                                {
                                        if (textSelectionInterval) {
                                                clearInterval(textSelectionInterval);
                                                textSelectionInterval = undefined;
                                        }
                                }
                               
                                function onTextSelectionScrollMouseMove(e)
                                {
                                        var offset = $this.parent().offset().top;
                                        var maxOffset = offset + paneHeight;
                                        var mouseOffset = getPos(e, 'Y');
                                        textDragDistanceAway = mouseOffset < offset ? mouseOffset - offset : (mouseOffset > maxOffset ? mouseOffset - maxOffset : 0);
                                        if (textDragDistanceAway == 0) {
                                                clearTextSelectionInterval();
                                        } else {
                                                if (!textSelectionInterval) {
                                                        textSelectionInterval  = setInterval(onTextSelectionInterval, 100);
                                                }
                                        }
                                }

                                function onSelectScrollMouseUp(e)
                                {
                                   $(document)
                                          .unbind('mousemove.jScrollPaneDragging')
                                          .unbind('mouseup.jScrollPaneDragging');
                                   clearTextSelectionInterval();
                                }

                                $container.bind('mousedown.jScrollPane', onSelectScrollMouseDown);

                               
                                $.jScrollPane.active.push($this[0]);
                               
                        } else {
                                $this.css(
                                        {
                                                'height':paneHeight+'px',
                                                'width':paneWidth-this.originalSidePaddingTotal+'px',
                                                'padding':this.originalPadding
                                        }
                                );
                                $this[0].scrollTo = $this[0].scrollBy = function() {};
                                // clean up listeners
                                $this.parent().unbind('mousewheel').unbind('mousedown.jScrollPane').unbind('keydown.jscrollpane').unbind('keyup.jscrollpane');
                        }
                       
                }
        )
};

$.fn.jScrollPaneRemove = function()
{
        $(this).each(function()
        {
                $this = $(this);
                var $c = $this.parent();
                if ($c.is('.jScrollPaneContainer')) {
                        $this.css(
                                {
                                        'top':'',
                                        'height':'',
                                        'width':'',
                                        'padding':'',
                                        'overflow':'',
                                        'position':''
                                }
                        );
                        $this.attr('style', $this.data('originalStyleTag'));
                        $c.after($this).remove();
                }
        });
}


$.fn.jScrollPane.defaults = {
        scrollbarWidth : 10,
        scrollbarMargin : 5,
        wheelSpeed : 18,
        showArrows : false,
        arrowSize : 0,
        animateTo : false,
        dragMinHeight : 1,
        dragMaxHeight : 99999,
        animateInterval : 100,
        animateStep: 3,
        maintainPosition: true,
        scrollbarOnLeft: false,
        reinitialiseOnImageLoad: false,
        tabIndex : 0,
        enableKeyboardNavigation: true,
        animateToInternalLinks: false,
        topCapHeight: 0,
        bottomCapHeight: 0,
        observeHash: true
};

// clean up the scrollTo expandos
$(window)
        .bind('unload', function() {
                var els = $.jScrollPane.active;
                for (var i=0; i<els.length; i++) {
                        els[i].scrollTo = els[i].scrollBy = null;
                }
        }
);

})(jQuery);



/* Copyright (c) 2009 Brandon Aaron (http://brandonaaron.net)
 * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php)
 * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses.
 * Thanks to: http://adomas.org/javascript-mouse-wheel/ for some pointers.
 * Thanks to: Mathias Bank(http://www.mathias-bank.de) for a scope bug fix.
 *
 * Version: 3.0.2
 * 
 * Requires: 1.2.2+
 */
(function(c){var a=["DOMMouseScroll","mousewheel"];c.event.special.mousewheel={setup:function(){if(this.addEventListener){for(var d=a.length;d;){this.addEventListener(a[--d],b,false)}}else{this.onmousewheel=b}},teardown:function(){if(this.removeEventListener){for(var d=a.length;d;){this.removeEventListener(a[--d],b,false)}}else{this.onmousewheel=null}}};c.fn.extend({mousewheel:function(d){return d?this.bind("mousewheel",d):this.trigger("mousewheel")},unmousewheel:function(d){return this.unbind("mousewheel",d)}});function b(f){var d=[].slice.call(arguments,1),g=0,e=true;f=c.event.fix(f||window.event);f.type="mousewheel";if(f.wheelDelta){g=f.wheelDelta/120}if(f.detail){g=-f.detail/3}d.unshift(f,g);return c.event.handle.apply(this,d)}})(jQuery);

/*
 *
 * jquery.json-2.2.min.js
 *
 */

(function($){$.toJSON=function(o)
{if(typeof(JSON)=='object'&&JSON.stringify)
return JSON.stringify(o);var type=typeof(o);if(o===null)
return"null";if(type=="undefined")
return undefined;if(type=="number"||type=="boolean")
return o+"";if(type=="string")
return $.quoteString(o);if(type=='object')
{if(typeof o.toJSON=="function")
return $.toJSON(o.toJSON());if(o.constructor===Date)
{var month=o.getUTCMonth()+1;if(month<10)month='0'+month;var day=o.getUTCDate();if(day<10)day='0'+day;var year=o.getUTCFullYear();var hours=o.getUTCHours();if(hours<10)hours='0'+hours;var minutes=o.getUTCMinutes();if(minutes<10)minutes='0'+minutes;var seconds=o.getUTCSeconds();if(seconds<10)seconds='0'+seconds;var milli=o.getUTCMilliseconds();if(milli<100)milli='0'+milli;if(milli<10)milli='0'+milli;return'"'+year+'-'+month+'-'+day+'T'+
hours+':'+minutes+':'+seconds+'.'+milli+'Z"';}
if(o.constructor===Array)
{var ret=[];for(var i=0;i<o.length;i++)
ret.push($.toJSON(o[i])||"null");return"["+ret.join(",")+"]";}
var pairs=[];for(var k in o){var name;var type=typeof k;if(type=="number")
name='"'+k+'"';else if(type=="string")
name=$.quoteString(k);else
continue;if(typeof o[k]=="function")
continue;var val=$.toJSON(o[k]);pairs.push(name+":"+val);}
return"{"+pairs.join(", ")+"}";}};$.evalJSON=function(src)
{if(typeof(JSON)=='object'&&JSON.parse)
return JSON.parse(src);return eval("("+src+")");};$.secureEvalJSON=function(src)
{if(typeof(JSON)=='object'&&JSON.parse)
return JSON.parse(src);var filtered=src;filtered=filtered.replace(/\\["\\\/bfnrtu]/g,'@');filtered=filtered.replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,']');filtered=filtered.replace(/(?:^|:|,)(?:\s*\[)+/g,'');if(/^[\],:{}\s]*$/.test(filtered))
return eval("("+src+")");else
throw new SyntaxError("Error parsing JSON, source is not valid.");};$.quoteString=function(string)
{if(string.match(_escapeable))
{return'"'+string.replace(_escapeable,function(a)
{var c=_meta[a];if(typeof c==='string')return c;c=a.charCodeAt();return'\\u00'+Math.floor(c/16).toString(16)+(c%16).toString(16);})+'"';}
return'"'+string+'"';};var _escapeable=/["\\\x00-\x1f\x7f-\x9f]/g;var _meta={'\b':'\\b','\t':'\\t','\n':'\\n','\f':'\\f','\r':'\\r','"':'\\"','\\':'\\\\'};})(jQuery);